C16H13FN2O3S — CID 17175619
methyl 3-[(2-fluorophenyl)carbamothioylcarbamoyl]benzoate (PubChem CID 17175619) has the molecular formula C16H13FN2O3S and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl 3-[(2-fluorophenyl)carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[(2-fluorophenyl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175619 |
| Molecular Formula | C16H13FN2O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | methyl 3-[(2-fluorophenyl)carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C16H13FN2O3S/c1-22-15(21)11-6-4-5-10(9-11)14(20)19-16(23)18-13-8-3-2-7-12(13)17/h2-9H,1H3,(H2,18,19,20,23) |
| InChIKey | HZNJHMBVGHBTDL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|