C25H23N3O4S — CID 17186901
methyl 3-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17186901) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is methyl 3-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17186901 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 3-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | CCN(C(=O)c1ccccc1NC(=S)NC(=O)c1cccc(C(=O)OC)c1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-3-28(19-12-5-4-6-13-19)23(30)20-14-7-8-15-21(20)26-25(33)27-22(29)17-10-9-11-18(16-17)24(31)32-2/h4-16H,3H2,1-2H3,(H2,26,27,29,33) |
| InChIKey | NMNQDCKIJQHMRM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|