C23H19Cl2N3O2S — CID 17186892
3,5-dichloro-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17186892) has the molecular formula C23H19Cl2N3O2S and a molecular weight of 472.40 g/mol. Its IUPAC name is 3,5-dichloro-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17186892 |
| Molecular Formula | C23H19Cl2N3O2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 3,5-dichloro-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCN(C(=O)c1ccccc1NC(=S)NC(=O)c1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N3O2S/c1-2-28(18-8-4-3-5-9-18)22(30)19-10-6-7-11-20(19)26-23(31)27-21(29)15-12-16(24)14-17(25)13-15/h3-14H,2H2,1H3,(H2,26,27,29,31) |
| InChIKey | SYHVFKGBFIEFPE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|