C16H13N3O6S — CID 17175537
methyl 3-[(2-hydroxy-5-nitrophenyl)carbamothioylcarbamoyl]benzoate (PubChem CID 17175537) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is methyl 3-[(2-hydroxy-5-nitrophenyl)carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[(2-hydroxy-5-nitrophenyl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175537 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | methyl 3-[(2-hydroxy-5-nitrophenyl)carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)Nc2cc([N+](=O)[O-])ccc2O)c1 |
| InChI | InChI=1S/C16H13N3O6S/c1-25-15(22)10-4-2-3-9(7-10)14(21)18-16(26)17-12-8-11(19(23)24)5-6-13(12)20/h2-8,20H,1H3,(H2,17,18,21,26) |
| InChIKey | RUGZDHKVHGIDEW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|