C22H19N3O5S — CID 4956850
N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 4956850) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 4956850 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1cc([N+](=O)[O-])ccc1O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3O5S/c26-20-11-8-17(25(28)29)14-19(20)23-22(31)24-21(27)16-6-9-18(10-7-16)30-13-12-15-4-2-1-3-5-15/h1-11,14,26H,12-13H2,(H2,23,24,27,31) |
| InChIKey | COBDTMWIMKTYGD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|