C15H13N3O5S — CID 4629121
N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-2-phenoxyacetamide (PubChem CID 4629121) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 4629121 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)carbamothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H13N3O5S/c19-13-7-6-10(18(21)22)8-12(13)16-15(24)17-14(20)9-23-11-4-2-1-3-5-11/h1-8,19H,9H2,(H2,16,17,20,24) |
| InChIKey | GHTCKJZQHVBCRA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|