C15H12FN3O4S — CID 3954462
N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-2-phenoxyacetamide (PubChem CID 3954462) has the molecular formula C15H12FN3O4S and a molecular weight of 349.34 g/mol. Its IUPAC name is N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 3954462 |
| Molecular Formula | C15H12FN3O4S |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12FN3O4S/c16-12-7-6-10(8-13(12)19(21)22)17-15(24)18-14(20)9-23-11-4-2-1-3-5-11/h1-8H,9H2,(H2,17,18,20,24) |
| InChIKey | RXYZMRXHRBBCCW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|