C17H14Cl3FN4O3S — CID 90094149
2-phenyl-N-[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 90094149) has the molecular formula C17H14Cl3FN4O3S and a molecular weight of 479.75 g/mol. Its IUPAC name is 2-phenyl-N-[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-phenyl-N-[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 90094149 |
| Molecular Formula | C17H14Cl3FN4O3S |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | 2-phenyl-N-[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | O=C(Cc1ccccc1)NC(NC(=S)Nc1ccc(F)c([N+](=O)[O-])c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H14Cl3FN4O3S/c18-17(19,20)15(23-14(26)8-10-4-2-1-3-5-10)24-16(29)22-11-6-7-12(21)13(9-11)25(27)28/h1-7,9,15H,8H2,(H,23,26)(H2,22,24,29) |
| InChIKey | AALCDQPWOLGHDM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|