C13H8Cl2FN3O2S — CID 17374901
1-(3,5-dichlorophenyl)-3-(4-fluoro-3-nitrophenyl)thiourea (PubChem CID 17374901) has the molecular formula C13H8Cl2FN3O2S and a molecular weight of 360.20 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(4-fluoro-3-nitrophenyl)thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(4-fluoro-3-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 17374901 |
| Molecular Formula | C13H8Cl2FN3O2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(4-fluoro-3-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1cc(NC(=S)Nc2cc(Cl)cc(Cl)c2)ccc1F |
| InChI | InChI=1S/C13H8Cl2FN3O2S/c14-7-3-8(15)5-10(4-7)18-13(22)17-9-1-2-11(16)12(6-9)19(20)21/h1-6H,(H2,17,18,22) |
| InChIKey | XFMWSBXWRQWHGJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|