C29H28Cl3FN4O6S — CID 6605267
ethyl 4-[3-[2-oxo-1-phenyl-2-[[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]amino]ethyl]phenoxy]butanoate (PubChem CID 6605267) has the molecular formula C29H28Cl3FN4O6S and a molecular weight of 685.99 g/mol. Its IUPAC name is ethyl 4-[3-[2-oxo-1-phenyl-2-[[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]amino]ethyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[3-[2-oxo-1-phenyl-2-[[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]amino]ethyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 6605267 |
| Molecular Formula | C29H28Cl3FN4O6S |
| Molecular Weight | 685.99 g/mol |
| Exact Mass | 684.08 |
| IUPAC Name | ethyl 4-[3-[2-oxo-1-phenyl-2-[[2,2,2-trichloro-1-[(4-fluoro-3-nitrophenyl)carbamothioylamino]ethyl]amino]ethyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cccc(C(C(=O)NC(NC(=S)Nc2ccc(F)c([N+](=O)[O-])c2)C(Cl)(Cl)Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28Cl3FN4O6S/c1-2-42-24(38)12-7-15-43-21-11-6-10-19(16-21)25(18-8-4-3-5-9-18)26(39)35-27(29(30,31)32)36-28(44)34-20-13-14-22(33)23(17-20)37(40)41/h3-6,8-11,13-14,16-17,25,27H,2,7,12,15H2,1H3,(H,35,39)(H2,34,36,44) |
| InChIKey | XLTNHRMEEWEGOC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|