C15H14N4O3S — CID 11438918
N-[[2-(methylamino)-5-nitrophenyl]carbamothioyl]benzamide (PubChem CID 11438918) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[[2-(methylamino)-5-nitrophenyl]carbamothioyl]benzamide.
| Compound Name | N-[[2-(methylamino)-5-nitrophenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 11438918 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[[2-(methylamino)-5-nitrophenyl]carbamothioyl]benzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N4O3S/c1-16-12-8-7-11(19(21)22)9-13(12)17-15(23)18-14(20)10-5-3-2-4-6-10/h2-9,16H,1H3,(H2,17,18,20,23) |
| InChIKey | BHSQNVAEXMAMRJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|