C18H18Cl2N4O2S — CID 35780060
2,4-dichloro-N-[2-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 35780060) has the molecular formula C18H18Cl2N4O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 35780060 |
| Molecular Formula | C18H18Cl2N4O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(NC(=S)NNC(=O)CNC(=O)c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C18H18Cl2N4O2S/c1-10-4-3-5-15(11(10)2)22-18(27)24-23-16(25)9-21-17(26)13-7-6-12(19)8-14(13)20/h3-8H,9H2,1-2H3,(H,21,26)(H,23,25)(H2,22,24,27) |
| InChIKey | HZDGKUPWWCVOPP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|