C20H17BrN2O3S2 — CID 98862254
N-[(4-bromothiophen-2-yl)methyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide (PubChem CID 98862254) has the molecular formula C20H17BrN2O3S2 and a molecular weight of 477.41 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 98862254 |
| Molecular Formula | C20H17BrN2O3S2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17BrN2O3S2/c21-17-12-19(27-14-17)13-22-20(24)16-6-8-18(9-7-16)23-28(25,26)11-10-15-4-2-1-3-5-15/h1-12,14,23H,13H2,(H,22,24)/b11-10+ |
| InChIKey | LRONZBXLJIKJAP-ZHACJKMWSA-N |
| XLogP | 4.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |