C18H15BrN2O3S2 — CID 55866733
3-(benzenesulfonamido)-N-[(4-bromothiophen-2-yl)methyl]benzamide (PubChem CID 55866733) has the molecular formula C18H15BrN2O3S2 and a molecular weight of 451.37 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[(4-bromothiophen-2-yl)methyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[(4-bromothiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55866733 |
| Molecular Formula | C18H15BrN2O3S2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[(4-bromothiophen-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H15BrN2O3S2/c19-14-10-16(25-12-14)11-20-18(22)13-5-4-6-15(9-13)21-26(23,24)17-7-2-1-3-8-17/h1-10,12,21H,11H2,(H,20,22) |
| InChIKey | MWMOEUHNLJVVDD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |