C25H19F3N2O3S — CID 31872227
4-[[(E)-2-phenylethenyl]sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 31872227) has the molecular formula C25H19F3N2O3S and a molecular weight of 484.50 g/mol. Its IUPAC name is 4-[[(E)-2-phenylethenyl]sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4-[[(E)-2-phenylethenyl]sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 31872227 |
| Molecular Formula | C25H19F3N2O3S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-[[(E)-2-phenylethenyl]sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19F3N2O3S/c26-25(27,28)22-10-4-8-20(18-22)9-5-16-29-24(31)21-11-13-23(14-12-21)30-34(32,33)17-15-19-6-2-1-3-7-19/h1-4,6-8,10-15,17-18,30H,16H2,(H,29,31)/b17-15+ |
| InChIKey | VFHSNFZBXQIPTA-BMRADRMJSA-N |
| XLogP | 4.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|