C23H15F5N2O3S — CID 39265859
4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 39265859) has the molecular formula C23H15F5N2O3S and a molecular weight of 494.44 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 39265859 |
| Molecular Formula | C23H15F5N2O3S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H15F5N2O3S/c24-20-11-10-19(14-21(20)25)34(32,33)30-18-8-6-16(7-9-18)22(31)29-12-2-4-15-3-1-5-17(13-15)23(26,27)28/h1,3,5-11,13-14,30H,12H2,(H,29,31) |
| InChIKey | HHEJDXLJKMMZSC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|