C18H12F3N3O — CID 31871647
N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-3H-benzimidazole-5-carboxamide (PubChem CID 31871647) has the molecular formula C18H12F3N3O and a molecular weight of 343.31 g/mol. Its IUPAC name is N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 31871647 |
| Molecular Formula | C18H12F3N3O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C18H12F3N3O/c19-18(20,21)14-5-1-3-12(9-14)4-2-8-22-17(25)13-6-7-15-16(10-13)24-11-23-15/h1,3,5-7,9-11H,8H2,(H,22,25)(H,23,24) |
| InChIKey | GUFDXQHTQONGCC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|