C17H10BrF4NO — CID 18272856
2-bromo-4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 18272856) has the molecular formula C17H10BrF4NO and a molecular weight of 400.17 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 2-bromo-4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 18272856 |
| Molecular Formula | C17H10BrF4NO |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-bromo-4-fluoro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C17H10BrF4NO/c18-15-10-13(19)6-7-14(15)16(24)23-8-2-4-11-3-1-5-12(9-11)17(20,21)22/h1,3,5-7,9-10H,8H2,(H,23,24) |
| InChIKey | IIUWCPSTJXUHNF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|