C19H15F3N2O5 — CID 31871227
4,5-dimethoxy-2-nitro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 31871227) has the molecular formula C19H15F3N2O5 and a molecular weight of 408.33 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4,5-dimethoxy-2-nitro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 31871227 |
| Molecular Formula | C19H15F3N2O5 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | COc1cc(C(=O)NCC#Cc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H15F3N2O5/c1-28-16-10-14(15(24(26)27)11-17(16)29-2)18(25)23-8-4-6-12-5-3-7-13(9-12)19(20,21)22/h3,5,7,9-11H,8H2,1-2H3,(H,23,25) |
| InChIKey | BHZHASDANCTHSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|