C23H22N2O4S — CID 24638590
N-(4-ethoxyphenyl)-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide (PubChem CID 24638590) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24638590 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c1-2-29-22-14-12-20(13-15-22)24-23(26)19-8-10-21(11-9-19)25-30(27,28)17-16-18-6-4-3-5-7-18/h3-17,25H,2H2,1H3,(H,24,26)/b17-16+ |
| InChIKey | IPFDPWBBCGVEHM-WUKNDPDISA-N |
| XLogP | 4.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |