C25H25N3O5S — CID 55350825
(E)-N-[4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-phenylethenesulfonamide (PubChem CID 55350825) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is (E)-N-[4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 55350825 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (E)-N-[4-[[[2-(3,4-dimethylphenoxy)acetyl]amino]carbamoyl]phenyl]-2-phenylethenesulfonamide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C25H25N3O5S/c1-18-8-13-23(16-19(18)2)33-17-24(29)26-27-25(30)21-9-11-22(12-10-21)28-34(31,32)15-14-20-6-4-3-5-7-20/h3-16,28H,17H2,1-2H3,(H,26,29)(H,27,30)/b15-14+ |
| InChIKey | PWAILJPXTQAEHI-CCEZHUSRSA-N |
| XLogP | 3.56 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|