C22H20N2O5S — CID 26712382
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-(phenylsulfamoyl)benzamide (PubChem CID 26712382) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26712382 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-(phenylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCCO2)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c25-22(23-18-9-12-20-21(15-18)29-14-4-13-28-20)16-7-10-19(11-8-16)30(26,27)24-17-5-2-1-3-6-17/h1-3,5-12,15,24H,4,13-14H2,(H,23,25) |
| InChIKey | BUJBHQGTDQCXKL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |