C23H30N4O3S2 — CID 50947671
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 50947671) has the molecular formula C23H30N4O3S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50947671 |
| Molecular Formula | C23H30N4O3S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2ccc(N3CCN(C)CC3)cc2)cc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H30N4O3S2/c1-25-13-15-26(16-14-25)19-7-5-18(6-8-19)24-32(29,30)20-9-10-22(31-2)21(17-20)23(28)27-11-3-4-12-27/h5-10,17,24H,3-4,11-16H2,1-2H3 |
| InChIKey | MYUJWZUBTSWDBC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|