C21H25N3O4S2 — CID 100505777
N-[2-methylsulfanyl-5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 100505777) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[2-methylsulfanyl-5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-methylsulfanyl-5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 100505777 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[2-methylsulfanyl-5-[[4-(piperidine-1-carbonyl)phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2ccc(C(=O)N3CCCCC3)cc2)cc1NC(C)=O |
| InChI | InChI=1S/C21H25N3O4S2/c1-15(25)22-19-14-18(10-11-20(19)29-2)30(27,28)23-17-8-6-16(7-9-17)21(26)24-12-4-3-5-13-24/h6-11,14,23H,3-5,12-13H2,1-2H3,(H,22,25) |
| InChIKey | IUVAVPXZJRIDLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |