C22H28N2O3S2 — CID 133160792
N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 133160792) has the molecular formula C22H28N2O3S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133160792 |
| Molecular Formula | C22H28N2O3S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanyl-3-(pyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | CCc1ccc(C(C)NS(=O)(=O)c2ccc(SC)c(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H28N2O3S2/c1-4-17-7-9-18(10-8-17)16(2)23-29(26,27)19-11-12-21(28-3)20(15-19)22(25)24-13-5-6-14-24/h7-12,15-16,23H,4-6,13-14H2,1-3H3 |
| InChIKey | MRSPEGVSHMFNNZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |