C17H26N2O4S2 — CID 133249991
N-(3-methylbutan-2-yl)-4-methylsulfanyl-3-(morpholine-4-carbonyl)benzenesulfonamide (PubChem CID 133249991) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-4-methylsulfanyl-3-(morpholine-4-carbonyl)benzenesulfonamide.
| Compound Name | N-(3-methylbutan-2-yl)-4-methylsulfanyl-3-(morpholine-4-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133249991 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(3-methylbutan-2-yl)-4-methylsulfanyl-3-(morpholine-4-carbonyl)benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)NC(C)C(C)C)cc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H26N2O4S2/c1-12(2)13(3)18-25(21,22)14-5-6-16(24-4)15(11-14)17(20)19-7-9-23-10-8-19/h5-6,11-13,18H,7-10H2,1-4H3 |
| InChIKey | YZBLDWMOKKEPRP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |