C14H16N2O2S2 — CID 110729387
5-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)thiophene-2-sulfonamide (PubChem CID 110729387) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 5-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110729387 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 5-methyl-N-(1-methyl-2,3-dihydroindol-5-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN3C)s1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-10-3-6-14(19-10)20(17,18)15-12-4-5-13-11(9-12)7-8-16(13)2/h3-6,9,15H,7-8H2,1-2H3 |
| InChIKey | OFGVHPJDZIUCRO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|