C14H21ClN2O3S — CID 114551610
[2-chloro-5-(3,4,5-trimethylpiperazin-1-yl)sulfonylphenyl]methanol (PubChem CID 114551610) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is [2-chloro-5-(3,4,5-trimethylpiperazin-1-yl)sulfonylphenyl]methanol.
| Compound Name | [2-chloro-5-(3,4,5-trimethylpiperazin-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 114551610 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [2-chloro-5-(3,4,5-trimethylpiperazin-1-yl)sulfonylphenyl]methanol |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Cl)c(CO)c2)CC(C)N1C |
| InChI | InChI=1S/C14H21ClN2O3S/c1-10-7-17(8-11(2)16(10)3)21(19,20)13-4-5-14(15)12(6-13)9-18/h4-6,10-11,18H,7-9H2,1-3H3 |
| InChIKey | AJRNFXBCTQNZTG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |