C14H20ClNO3S — CID 107090598
[2-chloro-4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]methanol (PubChem CID 107090598) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is [2-chloro-4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]methanol.
| Compound Name | [2-chloro-4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 107090598 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [2-chloro-4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]methanol |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-10-4-3-5-11(2)16(10)20(18,19)13-7-6-12(9-17)14(15)8-13/h6-8,10-11,17H,3-5,9H2,1-2H3 |
| InChIKey | YXKJDNSFDMZNEW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |