C13H16N2O2S — CID 107422446
5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,3-dihydro-1H-isoindole (PubChem CID 107422446) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 107422446 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2,3-dihydro-1H-isoindole |
| SMILES | O=S(=O)(c1ccc2c(c1)CNC2)N1CC=CCC1 |
| InChI | InChI=1S/C13H16N2O2S/c16-18(17,15-6-2-1-3-7-15)13-5-4-11-9-14-10-12(11)8-13/h1-2,4-5,8,14H,3,6-7,9-10H2 |
| InChIKey | MIVVBHHOAWVFHG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|