C15H22N2O2S — CID 114411261
N-[[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]methyl]propan-2-amine (PubChem CID 114411261) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114411261 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(S(=O)(=O)N2CC=CCC2)cc1 |
| InChI | InChI=1S/C15H22N2O2S/c1-13(2)16-12-14-6-8-15(9-7-14)20(18,19)17-10-4-3-5-11-17/h3-4,6-9,13,16H,5,10-12H2,1-2H3 |
| InChIKey | NEPFLRHVSMIXIR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|