C12H12N2O2S — CID 113356691
4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)benzonitrile (PubChem CID 113356691) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)benzonitrile.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)benzonitrile |
|---|---|
| PubChem CID | 113356691 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CC=CCC2)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c13-10-11-4-6-12(7-5-11)17(15,16)14-8-2-1-3-9-14/h1-2,4-7H,3,8-9H2 |
| InChIKey | AJGUXEBCRMTSPE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|