C14H22N2O2S2 — CID 114414151
N-[2-[5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]ethyl]propan-2-amine (PubChem CID 114414151) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is N-[2-[5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]ethyl]propan-2-amine.
| Compound Name | N-[2-[5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 114414151 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[2-[5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1ccc(S(=O)(=O)N2CC=CCC2)s1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-12(2)15-9-8-13-6-7-14(19-13)20(17,18)16-10-4-3-5-11-16/h3-4,6-7,12,15H,5,8-11H2,1-2H3 |
| InChIKey | HGJYAACNNQWCSJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|