C15H24N2O3S — CID 71921344
5-(2,2-dimethylmorpholin-4-yl)sulfonyl-N,N,2-trimethylaniline (PubChem CID 71921344) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-(2,2-dimethylmorpholin-4-yl)sulfonyl-N,N,2-trimethylaniline.
| Compound Name | 5-(2,2-dimethylmorpholin-4-yl)sulfonyl-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 71921344 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-(2,2-dimethylmorpholin-4-yl)sulfonyl-N,N,2-trimethylaniline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC(C)(C)C2)cc1N(C)C |
| InChI | InChI=1S/C15H24N2O3S/c1-12-6-7-13(10-14(12)16(4)5)21(18,19)17-8-9-20-15(2,3)11-17/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | WJNMGJCWXWHEHH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |