C13H21ClN4O2S — CID 64602429
3-chloro-N-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 64602429) has the molecular formula C13H21ClN4O2S and a molecular weight of 332.86 g/mol. Its IUPAC name is 3-chloro-N-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 64602429 |
| Molecular Formula | C13H21ClN4O2S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-chloro-N-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)N2CCN(C(C)C)CC2)cc1Cl |
| InChI | InChI=1S/C13H21ClN4O2S/c1-10(2)17-4-6-18(7-5-17)21(19,20)11-8-12(14)13(15-3)16-9-11/h8-10H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | JZKOJBDZIWBVOX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |