C9H11ClN4O — CID 104918759
4-(4-amino-6-chloro-2-pyridinyl)piperazin-2-one (PubChem CID 104918759) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is 4-(4-amino-6-chloro-2-pyridinyl)piperazin-2-one.
| Compound Name | 4-(4-amino-6-chloro-2-pyridinyl)piperazin-2-one |
|---|---|
| PubChem CID | 104918759 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-(4-amino-6-chloro-2-pyridinyl)piperazin-2-one |
| SMILES | Nc1cc(Cl)nc(N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C9H11ClN4O/c10-7-3-6(11)4-8(13-7)14-2-1-12-9(15)5-14/h3-4H,1-2,5H2,(H2,11,13)(H,12,15) |
| InChIKey | PZXLECZRJJFDAR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|