C13H15ClN6 — CID 104918719
2-chloro-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridin-4-amine (PubChem CID 104918719) has the molecular formula C13H15ClN6 and a molecular weight of 290.76 g/mol. Its IUPAC name is 2-chloro-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridin-4-amine.
| Compound Name | 2-chloro-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 104918719 |
| Molecular Formula | C13H15ClN6 |
| Molecular Weight | 290.76 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-chloro-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridin-4-amine |
| SMILES | Nc1cc(Cl)nc(N2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C13H15ClN6/c14-11-8-10(15)9-12(18-11)19-4-6-20(7-5-19)13-16-2-1-3-17-13/h1-3,8-9H,4-7H2,(H2,15,18) |
| InChIKey | SAWKCOBOUOBXOI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.76 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|