C10H13ClN4O — CID 104924420
4-(4-amino-6-chloro-2-pyridinyl)-1-methylpiperazin-2-one (PubChem CID 104924420) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 4-(4-amino-6-chloro-2-pyridinyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(4-amino-6-chloro-2-pyridinyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 104924420 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-(4-amino-6-chloro-2-pyridinyl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(N)cc(Cl)n2)CC1=O |
| InChI | InChI=1S/C10H13ClN4O/c1-14-2-3-15(6-10(14)16)9-5-7(12)4-8(11)13-9/h4-5H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | RYLAPIQQMWSEPL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|