C10H10ClF3N4O — CID 106767915
4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-1-methylpiperazin-2-one (PubChem CID 106767915) has the molecular formula C10H10ClF3N4O and a molecular weight of 294.66 g/mol. Its IUPAC name is 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-1-methylpiperazin-2-one.
| Compound Name | 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 106767915 |
| Molecular Formula | C10H10ClF3N4O |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(Cl)nc(C(F)(F)F)n2)CC1=O |
| InChI | InChI=1S/C10H10ClF3N4O/c1-17-2-3-18(5-8(17)19)7-4-6(11)15-9(16-7)10(12,13)14/h4H,2-3,5H2,1H3 |
| InChIKey | KNKINGRXVMEIJM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |