C13H18ClF3N4 — CID 106767317
4-(4-tert-butylpiperazin-1-yl)-6-chloro-2-(trifluoromethyl)pyrimidine (PubChem CID 106767317) has the molecular formula C13H18ClF3N4 and a molecular weight of 322.76 g/mol. Its IUPAC name is 4-(4-tert-butylpiperazin-1-yl)-6-chloro-2-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(4-tert-butylpiperazin-1-yl)-6-chloro-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 106767317 |
| Molecular Formula | C13H18ClF3N4 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(4-tert-butylpiperazin-1-yl)-6-chloro-2-(trifluoromethyl)pyrimidine |
| SMILES | CC(C)(C)N1CCN(c2cc(Cl)nc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C13H18ClF3N4/c1-12(2,3)21-6-4-20(5-7-21)10-8-9(14)18-11(19-10)13(15,16)17/h8H,4-7H2,1-3H3 |
| InChIKey | KQEDSNBBQDFAPA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |