C11H12ClF3N4O2 — CID 106768257
methyl N-[1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 106768257) has the molecular formula C11H12ClF3N4O2 and a molecular weight of 324.69 g/mol. Its IUPAC name is methyl N-[1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 106768257 |
| Molecular Formula | C11H12ClF3N4O2 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl N-[1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(c2cc(Cl)nc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H12ClF3N4O2/c1-21-10(20)16-6-2-3-19(5-6)8-4-7(12)17-9(18-8)11(13,14)15/h4,6H,2-3,5H2,1H3,(H,16,20) |
| InChIKey | KVHNAGLSKDMDQU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |