C12H16BrN3O2 — CID 113413422
methyl N-[1-(5-bromo-6-methyl-2-pyridinyl)pyrrolidin-3-yl]carbamate (PubChem CID 113413422) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is methyl N-[1-(5-bromo-6-methyl-2-pyridinyl)pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-(5-bromo-6-methyl-2-pyridinyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 113413422 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | methyl N-[1-(5-bromo-6-methyl-2-pyridinyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(c2ccc(Br)c(C)n2)C1 |
| InChI | InChI=1S/C12H16BrN3O2/c1-8-10(13)3-4-11(14-8)16-6-5-9(7-16)15-12(17)18-2/h3-4,9H,5-7H2,1-2H3,(H,15,17) |
| InChIKey | UCUOHFFVIAKOLA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |