C13H19ClN4O — CID 113402560
N-[1-(6-chloro-2-propan-2-ylpyrimidin-4-yl)pyrrolidin-3-yl]acetamide (PubChem CID 113402560) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is N-[1-(6-chloro-2-propan-2-ylpyrimidin-4-yl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(6-chloro-2-propan-2-ylpyrimidin-4-yl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 113402560 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[1-(6-chloro-2-propan-2-ylpyrimidin-4-yl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2cc(Cl)nc(C(C)C)n2)C1 |
| InChI | InChI=1S/C13H19ClN4O/c1-8(2)13-16-11(14)6-12(17-13)18-5-4-10(7-18)15-9(3)19/h6,8,10H,4-5,7H2,1-3H3,(H,15,19) |
| InChIKey | CJHPYOOWSHNBQW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |