C9H15N7O — CID 80915875
4-(2-amino-6-hydrazinylpyrimidin-4-yl)-1-methylpiperazin-2-one (PubChem CID 80915875) has the molecular formula C9H15N7O and a molecular weight of 237.27 g/mol. Its IUPAC name is 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 80915875 |
| Molecular Formula | C9H15N7O |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(NN)nc(N)n2)CC1=O |
| InChI | InChI=1S/C9H15N7O/c1-15-2-3-16(5-8(15)17)7-4-6(14-11)12-9(10)13-7/h4H,2-3,5,11H2,1H3,(H3,10,12,13,14) |
| InChIKey | ZXURGYACOIZWCU-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|