C10H16N6O — CID 102887852
4-(2,6-diaminopyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102887852) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 4-(2,6-diaminopyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2,6-diaminopyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102887852 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-(2,6-diaminopyrimidin-4-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2cc(N)nc(N)n2)CC1=O |
| InChI | InChI=1S/C10H16N6O/c1-15-3-2-4-16(6-9(15)17)8-5-7(11)13-10(12)14-8/h5H,2-4,6H2,1H3,(H4,11,12,13,14) |
| InChIKey | QXBKKJMJYBEMJE-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |