C10H15N5O — CID 102846599
4-(6-aminopyrazin-2-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102846599) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-(6-aminopyrazin-2-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(6-aminopyrazin-2-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102846599 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4-(6-aminopyrazin-2-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2cncc(N)n2)CC1=O |
| InChI | InChI=1S/C10H15N5O/c1-14-3-2-4-15(7-10(14)16)9-6-12-5-8(11)13-9/h5-6H,2-4,7H2,1H3,(H2,11,13) |
| InChIKey | YHHOAGXHENCSEW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |