C15H17ClN4O — CID 66580191
4-[3-(1-aminoethyl)-8-chloroquinolin-2-yl]piperazin-2-one (PubChem CID 66580191) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 4-[3-(1-aminoethyl)-8-chloroquinolin-2-yl]piperazin-2-one.
| Compound Name | 4-[3-(1-aminoethyl)-8-chloroquinolin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 66580191 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[3-(1-aminoethyl)-8-chloroquinolin-2-yl]piperazin-2-one |
| SMILES | CC(N)c1cc2cccc(Cl)c2nc1N1CCNC(=O)C1 |
| InChI | InChI=1S/C15H17ClN4O/c1-9(17)11-7-10-3-2-4-12(16)14(10)19-15(11)20-6-5-18-13(21)8-20/h2-4,7,9H,5-6,8,17H2,1H3,(H,18,21) |
| InChIKey | VSXXPQBXMCVCJL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |