C9H11N3O2S — CID 154945938
azane;2,4-dimethyl-6-nitro-1,3-benzothiazole (PubChem CID 154945938) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is azane;2,4-dimethyl-6-nitro-1,3-benzothiazole.
| Compound Name | azane;2,4-dimethyl-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 154945938 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | azane;2,4-dimethyl-6-nitro-1,3-benzothiazole |
| SMILES | Cc1nc2c(C)cc([N+](=O)[O-])cc2s1.N |
| InChI | InChI=1S/C9H8N2O2S.H3N/c1-5-3-7(11(12)13)4-8-9(5)10-6(2)14-8;/h3-4H,1-2H3;1H3 |
| InChIKey | IIUJLJAXRBDJJL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|