C15H20BNO2S — CID 175570066
2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (PubChem CID 175570066) has the molecular formula C15H20BNO2S and a molecular weight of 289.21 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole.
| Compound Name | 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 175570066 |
| Molecular Formula | C15H20BNO2S |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| SMILES | Cc1nc2c(C)cc(B3OC(C)(C)C(C)(C)O3)cc2s1 |
| InChI | InChI=1S/C15H20BNO2S/c1-9-7-11(8-12-13(9)17-10(2)20-12)16-18-14(3,4)15(5,6)19-16/h7-8H,1-6H3 |
| InChIKey | XQRYGAPDSJEFMF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|