C15H10N4O3S — CID 50878908
N-(4-methyl-6-nitro-1,3-benzothiazol-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 50878908) has the molecular formula C15H10N4O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is N-(4-methyl-6-nitro-1,3-benzothiazol-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-methyl-6-nitro-1,3-benzothiazol-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 50878908 |
| Molecular Formula | C15H10N4O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(4-methyl-6-nitro-1,3-benzothiazol-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])cc2sc(Nc3nc4ccccc4o3)nc12 |
| InChI | InChI=1S/C15H10N4O3S/c1-8-6-9(19(20)21)7-12-13(8)17-15(23-12)18-14-16-10-4-2-3-5-11(10)22-14/h2-7H,1H3,(H,16,17,18) |
| InChIKey | UXTIUMUZUNPSLD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|